C21H35N3O6 — CID 170647271
(11S)-2-[2-(cyclopropylamino)acetyl]-11-hydroxy-11-methoxy-7,13-dimethyl-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione (PubChem CID 170647271) has the molecular formula C21H35N3O6 and a molecular weight of 425.53 g/mol. Its IUPAC name is (11S)-2-[2-(cyclopropylamino)acetyl]-11-hydroxy-11-methoxy-7,13-dimethyl-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione.
| Compound Name | (11S)-2-[2-(cyclopropylamino)acetyl]-11-hydroxy-11-methoxy-7,13-dimethyl-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione |
|---|---|
| PubChem CID | 170647271 |
| Molecular Formula | C21H35N3O6 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (11S)-2-[2-(cyclopropylamino)acetyl]-11-hydroxy-11-methoxy-7,13-dimethyl-5-oxa-2,15-diazaspiro[3.12]hexadecane-6,8-dione |
| SMILES | CO[C@@]1(O)CCC(=O)C(C)C(=O)OC2(CNCC(C)C1)CN(C(=O)CNC1CC1)C2 |
| InChI | InChI=1S/C21H35N3O6/c1-14-8-21(28,29-3)7-6-17(25)15(2)19(27)30-20(11-22-9-14)12-24(13-20)18(26)10-23-16-4-5-16/h14-16,22-23,28H,4-13H2,1-3H3/t14?,15?,21-/m0/s1 |
| InChIKey | KCZJXDLPXIMHAZ-XFMWISLNSA-N |
| XLogP | -0.19 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|