C24H41N3O5 — CID 170647357
(11R)-11-methoxy-7,11,15-trimethyl-3-(pyrrolidine-2-carbonyl)-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione (PubChem CID 170647357) has the molecular formula C24H41N3O5 and a molecular weight of 451.61 g/mol. Its IUPAC name is (11R)-11-methoxy-7,11,15-trimethyl-3-(pyrrolidine-2-carbonyl)-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione.
| Compound Name | (11R)-11-methoxy-7,11,15-trimethyl-3-(pyrrolidine-2-carbonyl)-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
|---|---|
| PubChem CID | 170647357 |
| Molecular Formula | C24H41N3O5 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | (11R)-11-methoxy-7,11,15-trimethyl-3-(pyrrolidine-2-carbonyl)-17-oxa-3,7-diazaspiro[5.12]octadecane-14,16-dione |
| SMILES | CO[C@]1(C)CCCN(C)C2(CCN(C(=O)C3CCCN3)CC2)COC(=O)C(C)C(=O)CC1 |
| InChI | InChI=1S/C24H41N3O5/c1-18-20(28)8-10-23(2,31-4)9-6-14-26(3)24(17-32-22(18)30)11-15-27(16-12-24)21(29)19-7-5-13-25-19/h18-19,25H,5-17H2,1-4H3/t18?,19?,23-/m1/s1 |
| InChIKey | JCLRMKVXWWEGLI-MTNXOHHFSA-N |
| XLogP | 1.76 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|