C31H25FN6O — CID 170648896
5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(4-phenylphenyl)triazol-4-yl]indazole (PubChem CID 170648896) has the molecular formula C31H25FN6O and a molecular weight of 516.58 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(4-phenylphenyl)triazol-4-yl]indazole.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(4-phenylphenyl)triazol-4-yl]indazole |
|---|---|
| PubChem CID | 170648896 |
| Molecular Formula | C31H25FN6O |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(4-phenylphenyl)triazol-4-yl]indazole |
| SMILES | Fc1ncccc1-c1ccc2c(c1)c(-c1cn(-c3ccc(-c4ccccc4)cc3)nn1)nn2C1CCCCO1 |
| InChI | InChI=1S/C31H25FN6O/c32-31-25(9-6-17-33-31)23-13-16-28-26(19-23)30(35-38(28)29-10-4-5-18-39-29)27-20-37(36-34-27)24-14-11-22(12-15-24)21-7-2-1-3-8-21/h1-3,6-9,11-17,19-20,29H,4-5,10,18H2 |
| InChIKey | GZTNKPXWFGWCED-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|