C30H24FN7O — CID 170648924
5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(6-phenyl-3-pyridinyl)triazol-4-yl]indazole (PubChem CID 170648924) has the molecular formula C30H24FN7O and a molecular weight of 517.57 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(6-phenyl-3-pyridinyl)triazol-4-yl]indazole.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(6-phenyl-3-pyridinyl)triazol-4-yl]indazole |
|---|---|
| PubChem CID | 170648924 |
| Molecular Formula | C30H24FN7O |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)-3-[1-(6-phenyl-3-pyridinyl)triazol-4-yl]indazole |
| SMILES | Fc1ncccc1-c1ccc2c(c1)c(-c1cn(-c3ccc(-c4ccccc4)nc3)nn1)nn2C1CCCCO1 |
| InChI | InChI=1S/C30H24FN7O/c31-30-23(9-6-15-32-30)21-11-14-27-24(17-21)29(35-38(27)28-10-4-5-16-39-28)26-19-37(36-34-26)22-12-13-25(33-18-22)20-7-2-1-3-8-20/h1-3,6-9,11-15,17-19,28H,4-5,10,16H2 |
| InChIKey | XHGPGIGCHFAMPV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|