C39H33FN8O2 — CID 170648955
7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-N-naphthalen-1-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 170648955) has the molecular formula C39H33FN8O2 and a molecular weight of 664.75 g/mol. Its IUPAC name is 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-N-naphthalen-1-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-N-naphthalen-1-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 170648955 |
| Molecular Formula | C39H33FN8O2 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-N-naphthalen-1-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1CCc2ccc(-n3cc(-c4nn(C5CCCCO5)c5ccc(-c6cccnc6F)cc45)nn3)cc2C1 |
| InChI | InChI=1S/C39H33FN8O2/c40-38-31(10-6-18-41-38)27-14-16-35-32(22-27)37(44-48(35)36-12-3-4-20-50-36)34-24-47(45-43-34)29-15-13-25-17-19-46(23-28(25)21-29)39(49)42-33-11-5-8-26-7-1-2-9-30(26)33/h1-2,5-11,13-16,18,21-22,24,36H,3-4,12,17,19-20,23H2,(H,42,49) |
| InChIKey | FHTDNKBPKXZTNO-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|