C24H20FN7 — CID 170648971
7-[4-[5-(2-fluoro-3-pyridinyl)-1H-indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 170648971) has the molecular formula C24H20FN7 and a molecular weight of 425.47 g/mol. Its IUPAC name is 7-[4-[5-(2-fluoro-3-pyridinyl)-1H-indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1H-indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 170648971 |
| Molecular Formula | C24H20FN7 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1H-indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1NCCc2ccc(-n3cc(-c4n[nH]c5ccc(-c6cccnc6F)cc45)nn3)cc21 |
| InChI | InChI=1S/C24H20FN7/c1-14-19-12-17(6-4-15(19)8-10-26-14)32-13-22(29-31-32)23-20-11-16(5-7-21(20)28-30-23)18-3-2-9-27-24(18)25/h2-7,9,11-14,26H,8,10H2,1H3,(H,28,30) |
| InChIKey | KZIDWKFKGQWGHS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|