C35H32FN7O — CID 170649024
2-benzyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline (PubChem CID 170649024) has the molecular formula C35H32FN7O and a molecular weight of 585.69 g/mol. Its IUPAC name is 2-benzyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-benzyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 170649024 |
| Molecular Formula | C35H32FN7O |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 2-benzyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline |
| SMILES | Fc1ncccc1-c1ccc2c(c1)c(-c1cn(-c3ccc4c(c3)CN(Cc3ccccc3)CC4)nn1)nn2C1CCCCO1 |
| InChI | InChI=1S/C35H32FN7O/c36-35-29(9-6-16-37-35)26-12-14-32-30(20-26)34(39-43(32)33-10-4-5-18-44-33)31-23-42(40-38-31)28-13-11-25-15-17-41(22-27(25)19-28)21-24-7-2-1-3-8-24/h1-3,6-9,11-14,16,19-20,23,33H,4-5,10,15,17-18,21-22H2 |
| InChIKey | GJSSQTYLDAAWTP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|