C34H35FN8O2 — CID 170649127
N-cyclopentyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 170649127) has the molecular formula C34H35FN8O2 and a molecular weight of 606.71 g/mol. Its IUPAC name is N-cyclopentyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-cyclopentyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 170649127 |
| Molecular Formula | C34H35FN8O2 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | N-cyclopentyl-7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCc2ccc(-n3cc(-c4nn(C5CCCCO5)c5ccc(-c6cccnc6F)cc45)nn3)cc2C1 |
| InChI | InChI=1S/C34H35FN8O2/c35-33-27(8-5-15-36-33)23-11-13-30-28(19-23)32(39-43(30)31-9-3-4-17-45-31)29-21-42(40-38-29)26-12-10-22-14-16-41(20-24(22)18-26)34(44)37-25-6-1-2-7-25/h5,8,10-13,15,18-19,21,25,31H,1-4,6-7,9,14,16-17,20H2,(H,37,44) |
| InChIKey | LVPABVVXKHTBHQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|