About 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine
6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine (PubChem CID 170649487) has the molecular formula C12H17ClN4
and a molecular weight of 252.75 g/mol. Its IUPAC name is 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine |
| PubChem CID | 170649487 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine |
| SMILES | Nc1nc(Cl)ccc1CN1CC2CCC(C1)N2 |
| InChI | InChI=1S/C12H17ClN4/c13-11-4-1-8(12(14)16-11)5-17-6-9-2-3-10(7-17)15-9/h1,4,9-10,15H,2-3,5-7H2,(H2,14,16) |
| InChIKey | ZCKFJIZZUCDDQJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine?
The IUPAC name of 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine (CID 170649487) is 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine.
What is the SMILES notation for 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine?
The canonical SMILES for 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine is Nc1nc(Cl)ccc1CN1CC2CCC(C1)N2.
What is the InChIKey of 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine?
The InChIKey is ZCKFJIZZUCDDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN4/c13-11-4-1-8(12(14)16-11)5-17-6-9-2-3-10(7-17)15-9/h1,4,9-10,15H,2-3,5-7H2,(H2,14,16).
What are the key properties of 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine?
6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine has a molecular weight of 252.75 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(3,8-diazabicyclo[3.2.1]octan-3-ylmethyl)pyridin-2-amine is sourced from PubChem (CID 170649487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).