About 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine
2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine (PubChem CID 170649792) has the molecular formula C17H19N7O
and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine |
| PubChem CID | 170649792 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(N2C3CCC2COC3)nc1Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C17H19N7O/c18-13-4-6-16(24-11-2-3-12(24)9-25-8-11)20-17(13)19-10-1-5-14-15(7-10)22-23-21-14/h1,4-7,11-12H,2-3,8-9,18H2,(H,19,20)(H,21,22,23) |
| InChIKey | VZTOVYHILIPZEC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine?
The IUPAC name of 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine (CID 170649792) is 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine.
What is the SMILES notation for 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine?
The canonical SMILES for 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine is Nc1ccc(N2C3CCC2COC3)nc1Nc1ccc2n[nH]nc2c1.
What is the InChIKey of 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine?
The InChIKey is VZTOVYHILIPZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N7O/c18-13-4-6-16(24-11-2-3-12(24)9-25-8-11)20-17(13)19-10-1-5-14-15(7-10)22-23-21-14/h1,4-7,11-12H,2-3,8-9,18H2,(H,19,20)(H,21,22,23).
What are the key properties of 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine?
2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine has a molecular weight of 337.39 g/mol, XLogP of 2.05, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2H-benzotriazol-5-yl)-6-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)pyridine-2,3-diamine is sourced from PubChem (CID 170649792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).