About [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate
[1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate (PubChem CID 170651077) has the molecular formula C21H26Cl2N2O3
and a molecular weight of 425.36 g/mol. Its IUPAC name is [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate |
| PubChem CID | 170651077 |
| Molecular Formula | C21H26Cl2N2O3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate |
| SMILES | CC(C#Cc1ccc(Cl)c(Cl)c1)NC(=O)C1(OC(=O)NC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C21H26Cl2N2O3/c1-14(7-8-15-9-10-16(22)17(23)13-15)24-18(26)21(11-5-6-12-21)28-19(27)25-20(2,3)4/h9-10,13-14H,5-6,11-12H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | HUJBLXXIBQYCKE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate?
The IUPAC name of [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate (CID 170651077) is [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate.
What is the SMILES notation for [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate?
The canonical SMILES for [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate is CC(C#Cc1ccc(Cl)c(Cl)c1)NC(=O)C1(OC(=O)NC(C)(C)C)CCCC1.
What is the InChIKey of [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate?
The InChIKey is HUJBLXXIBQYCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26Cl2N2O3/c1-14(7-8-15-9-10-16(22)17(23)13-15)24-18(26)21(11-5-6-12-21)28-19(27)25-20(2,3)4/h9-10,13-14H,5-6,11-12H2,1-4H3,(H,24,26)(H,25,27).
What are the key properties of [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate?
[1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate has a molecular weight of 425.36 g/mol, XLogP of 4.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(3,4-dichlorophenyl)but-3-yn-2-ylcarbamoyl]cyclopentyl] N-tert-butylcarbamate is sourced from PubChem (CID 170651077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).