C16H22ClF3N2O4 — CID 170651173
2,2-dimethylhexan-3-yl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate (PubChem CID 170651173) has the molecular formula C16H22ClF3N2O4 and a molecular weight of 398.81 g/mol. Its IUPAC name is 2,2-dimethylhexan-3-yl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate.
| Compound Name | 2,2-dimethylhexan-3-yl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170651173 |
| Molecular Formula | C16H22ClF3N2O4 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2,2-dimethylhexan-3-yl N-[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamate |
| SMILES | CCCC(OC(=O)Nc1c(C(O)(O)C(F)(F)F)ccnc1Cl)C(C)(C)C |
| InChI | InChI=1S/C16H22ClF3N2O4/c1-5-6-10(14(2,3)4)26-13(23)22-11-9(7-8-21-12(11)17)15(24,25)16(18,19)20/h7-8,10,24-25H,5-6H2,1-4H3,(H,22,23) |
| InChIKey | KCEAEUMBKAMCRI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|