About 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine
2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine (PubChem CID 170651568) has the molecular formula C15H24FNO
and a molecular weight of 253.36 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine |
| PubChem CID | 170651568 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine |
| SMILES | CC(C)(C)CCOc1cc(F)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H24FNO/c1-14(2,3)7-8-18-13-10-11(16)9-12(17-13)15(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | BQUTZFMGTYGIOM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine?
The IUPAC name of 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine (CID 170651568) is 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine.
What is the SMILES notation for 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine?
The canonical SMILES for 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine is CC(C)(C)CCOc1cc(F)cc(C(C)(C)C)n1.
What is the InChIKey of 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine?
The InChIKey is BQUTZFMGTYGIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24FNO/c1-14(2,3)7-8-18-13-10-11(16)9-12(17-13)15(4,5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine?
2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine has a molecular weight of 253.36 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(3,3-dimethylbutoxy)-4-fluoropyridine is sourced from PubChem (CID 170651568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).