About 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole
1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole (PubChem CID 170651576) has the molecular formula C14H22F2N2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole |
| PubChem CID | 170651576 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole |
| SMILES | CC(F)(F)C1CCC(c2ccn(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C14H22F2N2/c1-13(2,3)18-8-7-12(17-18)10-5-6-11(9-10)14(4,15)16/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | RJIDAEXZQFIFIP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole?
The IUPAC name of 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole (CID 170651576) is 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole.
What is the SMILES notation for 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole?
The canonical SMILES for 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole is CC(F)(F)C1CCC(c2ccn(C(C)(C)C)n2)C1.
What is the InChIKey of 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole?
The InChIKey is RJIDAEXZQFIFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2/c1-13(2,3)18-8-7-12(17-18)10-5-6-11(9-10)14(4,15)16/h7-8,10-11H,5-6,9H2,1-4H3.
What are the key properties of 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole?
1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole has a molecular weight of 256.34 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[3-(1,1-difluoroethyl)cyclopentyl]pyrazole is sourced from PubChem (CID 170651576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).