About 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene
1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene (PubChem CID 170651666) has the molecular formula C16H21F3O
and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene |
| PubChem CID | 170651666 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene |
| SMILES | CC(C)(C)c1cccc([C@@H]2CC[C@@H](OC(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H21F3O/c1-15(2,3)13-6-4-5-11(9-13)12-7-8-14(10-12)20-16(17,18)19/h4-6,9,12,14H,7-8,10H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | CVBSLBCVVHMUAH-TZMCWYRMSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene?
The IUPAC name of 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene (CID 170651666) is 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene.
What is the SMILES notation for 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene?
The canonical SMILES for 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene is CC(C)(C)c1cccc([C@@H]2CC[C@@H](OC(F)(F)F)C2)c1.
What is the InChIKey of 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene?
The InChIKey is CVBSLBCVVHMUAH-TZMCWYRMSA-N. The full InChI is InChI=1S/C16H21F3O/c1-15(2,3)13-6-4-5-11(9-13)12-7-8-14(10-12)20-16(17,18)19/h4-6,9,12,14H,7-8,10H2,1-3H3/t12-,14-/m1/s1.
What are the key properties of 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene?
1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene has a molecular weight of 286.34 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[(1R,3R)-3-(trifluoromethoxy)cyclopentyl]benzene is sourced from PubChem (CID 170651666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).