C17H13BN2O3 — CID 170652460
2-(1H-imidazol-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one (PubChem CID 170652460) has the molecular formula C17H13BN2O3 and a molecular weight of 304.11 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one.
| Compound Name | 2-(1H-imidazol-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one |
|---|---|
| PubChem CID | 170652460 |
| Molecular Formula | C17H13BN2O3 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one |
| SMILES | O=C1OB(c2ncc[nH]2)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13BN2O3/c21-15-17(13-7-3-1-4-8-13,14-9-5-2-6-10-14)23-18(22-15)16-19-11-12-20-16/h1-12H,(H,19,20) |
| InChIKey | IRZPZKDFRZFEJA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|