C42H26O — CID 170653878
1,2,3,4,5,6,8,9,10-nonadeuterio-7-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran (PubChem CID 170653878) has the molecular formula C42H26O and a molecular weight of 564.78 g/mol. Its IUPAC name is 1,2,3,4,5,6,8,9,10-nonadeuterio-7-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran.
| Compound Name | 1,2,3,4,5,6,8,9,10-nonadeuterio-7-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 170653878 |
| Molecular Formula | C42H26O |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | 1,2,3,4,5,6,8,9,10-nonadeuterio-7-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c([2H])c2-c2c3ccccc3c(-c3c([2H])c([2H])c([2H])c4oc5c6c([2H])c([2H])c([2H])c([2H])c6c([2H])c([2H])c5c34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C42H26O/c1-2-13-27(14-3-1)29-16-6-7-18-31(29)39-32-19-8-10-21-34(32)40(35-22-11-9-20-33(35)39)36-23-12-24-38-41(36)37-26-25-28-15-4-5-17-30(28)42(37)43-38/h1-26H/i1D,2D,3D,4D,5D,6D,7D,12D,13D,14D,15D,16D,17D,18D,23D,24D,25D,26D |
| InChIKey | KILRKRAIRHUFLO-MTCBBWKDSA-N |
| XLogP | 12.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|