C26H19BO2 — CID 170653996
[10-(2,3,4,6-tetradeuterio-5-phenylphenyl)anthracen-9-yl]boronic acid (PubChem CID 170653996) has the molecular formula C26H19BO2 and a molecular weight of 378.27 g/mol. Its IUPAC name is [10-(2,3,4,6-tetradeuterio-5-phenylphenyl)anthracen-9-yl]boronic acid.
| Compound Name | [10-(2,3,4,6-tetradeuterio-5-phenylphenyl)anthracen-9-yl]boronic acid |
|---|---|
| PubChem CID | 170653996 |
| Molecular Formula | C26H19BO2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [10-(2,3,4,6-tetradeuterio-5-phenylphenyl)anthracen-9-yl]boronic acid |
| SMILES | [2H]c1c([2H])c(-c2ccccc2)c([2H])c(-c2c3ccccc3c(B(O)O)c3ccccc23)c1[2H] |
| InChI | InChI=1S/C26H19BO2/c28-27(29)26-23-15-6-4-13-21(23)25(22-14-5-7-16-24(22)26)20-12-8-11-19(17-20)18-9-2-1-3-10-18/h1-17,28-29H/i8D,11D,12D,17D |
| InChIKey | UKDBUZJPKSZSTR-KBVDQDMASA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|