C54H57BN2S — CID 170654115
4,11-ditert-butyl-8,14-bis(4-tert-butylphenyl)-18-phenyl-22-thia-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16(21),17,19-decaene (PubChem CID 170654115) has the molecular formula C54H57BN2S and a molecular weight of 776.94 g/mol. Its IUPAC name is 4,11-ditert-butyl-8,14-bis(4-tert-butylphenyl)-18-phenyl-22-thia-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16(21),17,19-decaene.
| Compound Name | 4,11-ditert-butyl-8,14-bis(4-tert-butylphenyl)-18-phenyl-22-thia-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16(21),17,19-decaene |
|---|---|
| PubChem CID | 170654115 |
| Molecular Formula | C54H57BN2S |
| Molecular Weight | 776.94 g/mol |
| Exact Mass | 776.43 |
| IUPAC Name | 4,11-ditert-butyl-8,14-bis(4-tert-butylphenyl)-18-phenyl-22-thia-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16(21),17,19-decaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4sc5ccc(-c6ccccc6)cc5c4N(c4ccc(C(C)(C)C)cc4)c4cc(C(C)(C)C)cc2c43)cc1 |
| InChI | InChI=1S/C54H57BN2S/c1-51(2,3)36-19-24-40(25-20-36)56-44-28-23-38(53(7,8)9)31-43(44)55-48-45(56)32-39(54(10,11)12)33-46(48)57(41-26-21-37(22-27-41)52(4,5)6)49-42-30-35(34-16-14-13-15-17-34)18-29-47(42)58-50(49)55/h13-33H,1-12H3 |
| InChIKey | IXTHISSCPNKCEC-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.94 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|