C28H58S2 — CID 170655572
1-[8-(7,7-dimethyloctylsulfanyl)octylsulfanyl]-7,7-dimethyloctane (PubChem CID 170655572) has the molecular formula C28H58S2 and a molecular weight of 458.91 g/mol. Its IUPAC name is 1-[8-(7,7-dimethyloctylsulfanyl)octylsulfanyl]-7,7-dimethyloctane.
| Compound Name | 1-[8-(7,7-dimethyloctylsulfanyl)octylsulfanyl]-7,7-dimethyloctane |
|---|---|
| PubChem CID | 170655572 |
| Molecular Formula | C28H58S2 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.40 |
| IUPAC Name | 1-[8-(7,7-dimethyloctylsulfanyl)octylsulfanyl]-7,7-dimethyloctane |
| SMILES | CC(C)(C)CCCCCCSCCCCCCCCSCCCCCCC(C)(C)C |
| InChI | InChI=1S/C28H58S2/c1-27(2,3)21-15-9-13-19-25-29-23-17-11-7-8-12-18-24-30-26-20-14-10-16-22-28(4,5)6/h7-26H2,1-6H3 |
| InChIKey | RGZZGBVQABRLPT-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|