About CID 170656068
CID 170656068 (PubChem CID 170656068) has the molecular formula C30H23N7O10S2+2
and a molecular weight of 705.69 g/mol.
Molecular Properties
| Compound Name | CID 170656068 |
| PubChem CID | 170656068 |
| Molecular Formula | C30H23N7O10S2+2 |
| Molecular Weight | 705.69 g/mol |
| Exact Mass | 705.09 |
| IUPAC Name | — |
| SMILES | Nc1ccc2c(-c3ccc(C(=O)NCc4ccc(-c5nncnn5)cc4)cc3C(=O)O)c3ccc(=[NH2+])c(S(=O)(=O)O)c-3oc2c1[S+](=O)(O)O |
| InChI | InChI=1S/C30H21N7O10S2/c31-21-9-7-18-23(19-8-10-22(32)27(49(44,45)46)25(19)47-24(18)26(21)48(41,42)43)17-6-5-16(11-20(17)30(39)40)29(38)33-12-14-1-3-15(4-2-14)28-36-34-13-35-37-28/h1-11,13H,12H2,(H7-,31,32,33,38,39,40,41,42,43,44,45,46)/p+2 |
| InChIKey | ZYIDNRUXFBSMPI-UHFFFAOYSA-P |
| XLogP | 1.37 |
| TPSA | 294.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 705.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 170656068 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170656068?
The IUPAC name of CID 170656068 (CID 170656068) is not available.
What is the SMILES notation for CID 170656068?
The canonical SMILES for CID 170656068 is Nc1ccc2c(-c3ccc(C(=O)NCc4ccc(-c5nncnn5)cc4)cc3C(=O)O)c3ccc(=[NH2+])c(S(=O)(=O)O)c-3oc2c1[S+](=O)(O)O.
What is the InChIKey of CID 170656068?
The InChIKey is ZYIDNRUXFBSMPI-UHFFFAOYSA-P. The full InChI is InChI=1S/C30H21N7O10S2/c31-21-9-7-18-23(19-8-10-22(32)27(49(44,45)46)25(19)47-24(18)26(21)48(41,42)43)17-6-5-16(11-20(17)30(39)40)29(38)33-12-14-1-3-15(4-2-14)28-36-34-13-35-37-28/h1-11,13H,12H2,(H7-,31,32,33,38,39,40,41,42,43,44,45,46)/p+2.
What are the key properties of CID 170656068?
CID 170656068 has a molecular weight of 705.69 g/mol, XLogP of 1.37, 8 rotatable bonds, 7 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170656068 is sourced from PubChem (CID 170656068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).