C29H30F3NO6 — CID 170656092
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(4-methoxyphenoxy)-2-(2-phenylphenyl)acetate;2,2,2-trifluoroacetate (PubChem CID 170656092) has the molecular formula C29H30F3NO6 and a molecular weight of 545.55 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(4-methoxyphenoxy)-2-(2-phenylphenyl)acetate;2,2,2-trifluoroacetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(4-methoxyphenoxy)-2-(2-phenylphenyl)acetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170656092 |
| Molecular Formula | C29H30F3NO6 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-(4-methoxyphenoxy)-2-(2-phenylphenyl)acetate;2,2,2-trifluoroacetate |
| SMILES | COc1ccc(OC(C(=O)OC2CC[N+](C)(C)C2)c2ccccc2-c2ccccc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H30NO4.C2HF3O2/c1-28(2)18-17-23(19-28)32-27(29)26(31-22-15-13-21(30-3)14-16-22)25-12-8-7-11-24(25)20-9-5-4-6-10-20;3-2(4,5)1(6)7/h4-16,23,26H,17-19H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | SQQWQYZIOMUDQX-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|