C52H44N2O — CID 170656424
N,N-bis(9,9-dimethylfluoren-2-yl)-3,14,14-trimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-16-amine (PubChem CID 170656424) has the molecular formula C52H44N2O and a molecular weight of 712.94 g/mol. Its IUPAC name is N,N-bis(9,9-dimethylfluoren-2-yl)-3,14,14-trimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-16-amine.
| Compound Name | N,N-bis(9,9-dimethylfluoren-2-yl)-3,14,14-trimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-16-amine |
|---|---|
| PubChem CID | 170656424 |
| Molecular Formula | C52H44N2O |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 712.35 |
| IUPAC Name | N,N-bis(9,9-dimethylfluoren-2-yl)-3,14,14-trimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-16-amine |
| SMILES | Cc1cccc2c1N1c3cccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3C(C)(C)c3cccc(c31)O2 |
| InChI | InChI=1S/C52H44N2O/c1-31-15-12-23-45-48(31)54-44-22-14-21-43(47(44)52(6,7)40-20-13-24-46(55-45)49(40)54)53(32-25-27-36-34-16-8-10-18-38(34)50(2,3)41(36)29-32)33-26-28-37-35-17-9-11-19-39(35)51(4,5)42(37)30-33/h8-30H,1-7H3 |
| InChIKey | SSMCGXUUAQSBAZ-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |