About 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate
1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate (PubChem CID 170657136) has the molecular formula C41H74O9
and a molecular weight of 711.03 g/mol. Its IUPAC name is 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate.
Molecular Properties
| Compound Name | 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate |
| PubChem CID | 170657136 |
| Molecular Formula | C41H74O9 |
| Molecular Weight | 711.03 g/mol |
| Exact Mass | 710.53 |
| IUPAC Name | 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate |
| SMILES | CCCCCCCC[C@H](CC)OC(=O)CCCCCCC(=O)OCC(=O)COC(=O)CCCCCCC(=O)O[C@@H](CC)CCCCCCCC |
| InChI | InChI=1S/C41H74O9/c1-5-9-11-13-15-21-27-36(7-3)49-40(45)31-25-19-17-23-29-38(43)47-33-35(42)34-48-39(44)30-24-18-20-26-32-41(46)50-37(8-4)28-22-16-14-12-10-6-2/h36-37H,5-34H2,1-4H3/t36-,37-/m0/s1 |
| InChIKey | PVGUCFBVEMFHSS-BCRBLDSWSA-N |
| XLogP | 10.47 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 711.03 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate?
The IUPAC name of 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate (CID 170657136) is 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate.
What is the SMILES notation for 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate?
The canonical SMILES for 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate is CCCCCCCC[C@H](CC)OC(=O)CCCCCCC(=O)OCC(=O)COC(=O)CCCCCCC(=O)O[C@@H](CC)CCCCCCCC.
What is the InChIKey of 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate?
The InChIKey is PVGUCFBVEMFHSS-BCRBLDSWSA-N. The full InChI is InChI=1S/C41H74O9/c1-5-9-11-13-15-21-27-36(7-3)49-40(45)31-25-19-17-23-29-38(43)47-33-35(42)34-48-39(44)30-24-18-20-26-32-41(46)50-37(8-4)28-22-16-14-12-10-6-2/h36-37H,5-34H2,1-4H3/t36-,37-/m0/s1.
What are the key properties of 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate?
1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate has a molecular weight of 711.03 g/mol, XLogP of 10.47, 36 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-oxo-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate is sourced from PubChem (CID 170657136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).