C22H27F2N7O2 — CID 170657296
4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 170657296) has the molecular formula C22H27F2N7O2 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 170657296 |
| Molecular Formula | C22H27F2N7O2 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(NC4CCC(C)(O)CC4)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C22H27F2N7O2/c1-22(32)8-5-14(6-9-22)27-21-28-20(33-2)19-15(7-10-31(19)30-21)13-3-4-16(29-25)17(11-13)26-12-18(23)24/h3-4,7,10-11,14,18,25-26,32H,5-6,8-9,12H2,1-2H3,(H,27,30)/b29-25+ |
| InChIKey | OFBHQGWDDHAQEK-XLVZBRSZSA-N |
| XLogP | 4.85 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|