C23H27F2N7O2 — CID 170657326
4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 170657326) has the molecular formula C23H27F2N7O2 and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 170657326 |
| Molecular Formula | C23H27F2N7O2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[[5-[1-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-6-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | COc1nc(NC2CCC(C)(O)CC2)nn2ccc(-c3cnc4nc(C)n(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C23H27F2N7O2/c1-13-27-20-17(31(13)12-18(24)25)10-14(11-26-20)16-6-9-32-19(16)21(34-3)29-22(30-32)28-15-4-7-23(2,33)8-5-15/h6,9-11,15,18,33H,4-5,7-8,12H2,1-3H3,(H,28,30) |
| InChIKey | KOKKVOLKWFDIGA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |