C22H24F3N7O2 — CID 170657380
4-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 170657380) has the molecular formula C22H24F3N7O2 and a molecular weight of 475.48 g/mol. Its IUPAC name is 4-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 170657380 |
| Molecular Formula | C22H24F3N7O2 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | COc1nc(NC2CCC(C)(O)CC2)nn2ccc(-c3ccc4nnn(CC(F)(F)F)c4c3)c12 |
| InChI | InChI=1S/C22H24F3N7O2/c1-21(33)8-5-14(6-9-21)26-20-27-19(34-2)18-15(7-10-31(18)29-20)13-3-4-16-17(11-13)32(30-28-16)12-22(23,24)25/h3-4,7,10-11,14,33H,5-6,8-9,12H2,1-2H3,(H,26,29) |
| InChIKey | TVNSYOVCUWOIPN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |