C24H29F3N8O2 — CID 170657382
5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170657382) has the molecular formula C24H29F3N8O2 and a molecular weight of 518.54 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170657382 |
| Molecular Formula | C24H29F3N8O2 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@H]4CCN(C5(C)COC5)C[C@H]4F)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C24H29F3N8O2/c1-24(12-37-13-24)34-7-6-17(16(25)11-34)30-23-31-22(36-2)21-15(5-8-35(21)33-23)14-3-4-18(32-28)19(9-14)29-10-20(26)27/h3-5,8-9,16-17,20,28-29H,6-7,10-13H2,1-2H3,(H,30,33)/b32-28+/t16-,17+/m1/s1 |
| InChIKey | XYIKHUNCZDPTRJ-OQXCVQBLSA-N |
| XLogP | 4.36 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|