C21H23F2N7O2 — CID 170657388
4-[[4-(2,2-difluoroethoxy)-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 170657388) has the molecular formula C21H23F2N7O2 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-[[4-(2,2-difluoroethoxy)-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[4-(2,2-difluoroethoxy)-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 170657388 |
| Molecular Formula | C21H23F2N7O2 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[[4-(2,2-difluoroethoxy)-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2nc(OCC(F)F)c3c(-c4ccc5ncnn5c4)ccn3n2)CC1 |
| InChI | InChI=1S/C21H23F2N7O2/c1-21(31)7-4-14(5-8-21)26-20-27-19(32-11-16(22)23)18-15(6-9-29(18)28-20)13-2-3-17-24-12-25-30(17)10-13/h2-3,6,9-10,12,14,16,31H,4-5,7-8,11H2,1H3,(H,26,28) |
| InChIKey | WFIASNVNKYVDPU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |