C22H25F3N8O2 — CID 170657472
1-[(3R,4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone (PubChem CID 170657472) has the molecular formula C22H25F3N8O2 and a molecular weight of 490.49 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone.
| Compound Name | 1-[(3R,4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170657472 |
| Molecular Formula | C22H25F3N8O2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1-[(3R,4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@H]4CCN(C(C)=O)C[C@H]4F)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C22H25F3N8O2/c1-12(34)32-7-6-16(15(23)11-32)28-22-29-21(35-2)20-14(5-8-33(20)31-22)13-3-4-17(30-26)18(9-13)27-10-19(24)25/h3-5,8-9,15-16,19,26-27H,6-7,10-11H2,1-2H3,(H,28,31)/b30-26+/t15-,16+/m1/s1 |
| InChIKey | NWOROZLKIMWNAA-RBADJGKTSA-N |
| XLogP | 4.12 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|