C18H17F2N7O — CID 170657515
N-(3,3-difluorocyclopentyl)-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170657515) has the molecular formula C18H17F2N7O and a molecular weight of 385.38 g/mol. Its IUPAC name is N-(3,3-difluorocyclopentyl)-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-(3,3-difluorocyclopentyl)-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170657515 |
| Molecular Formula | C18H17F2N7O |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(3,3-difluorocyclopentyl)-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(NC2CCC(F)(F)C2)nn2ccc(-c3cnc4nccn4c3)c12 |
| InChI | InChI=1S/C18H17F2N7O/c1-28-15-14-13(11-9-22-17-21-5-7-26(17)10-11)3-6-27(14)25-16(24-15)23-12-2-4-18(19,20)8-12/h3,5-7,9-10,12H,2,4,8H2,1H3,(H,23,25) |
| InChIKey | KFFVRIYUOLTFJX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |