C51H34N4 — CID 170658651
9-[2-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 170658651) has the molecular formula C51H34N4 and a molecular weight of 707.89 g/mol. Its IUPAC name is 9-[2-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[2-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 170658651 |
| Molecular Formula | C51H34N4 |
| Molecular Weight | 707.89 g/mol |
| Exact Mass | 707.31 |
| IUPAC Name | 9-[2-(2,3,4,5,6-pentadeuteriophenyl)-5-[4-phenyl-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccc(-c6ccccc6)cc5)c4)n3)cc2-n2c3ccccc3c3ccccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H34N4/c1-4-15-35(16-5-1)36-27-29-37(30-28-36)40-21-14-22-41(33-40)50-52-49(39-19-8-3-9-20-39)53-51(54-50)42-31-32-43(38-17-6-2-7-18-38)48(34-42)55-46-25-12-10-23-44(46)45-24-11-13-26-47(45)55/h1-34H/i2D,6D,7D,17D,18D |
| InChIKey | VLNVVUBISLUDHR-MSQAAWSKSA-N |
| XLogP | 12.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.89 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |