About 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol
4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol (PubChem CID 170659388) has the molecular formula C19H22FNO
and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol.
Molecular Properties
| Compound Name | 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol |
| PubChem CID | 170659388 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol |
| SMILES | CC(C)(CCc1ccc(O)cc1)N1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C19H22FNO/c1-19(2,10-9-14-3-7-18(22)8-4-14)21-12-15-5-6-17(20)11-16(15)13-21/h3-8,11,22H,9-10,12-13H2,1-2H3 |
| InChIKey | XDEHWDHWHGFYRF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol?
The IUPAC name of 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol (CID 170659388) is 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol.
What is the SMILES notation for 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol?
The canonical SMILES for 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol is CC(C)(CCc1ccc(O)cc1)N1Cc2ccc(F)cc2C1.
What is the InChIKey of 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol?
The InChIKey is XDEHWDHWHGFYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO/c1-19(2,10-9-14-3-7-18(22)8-4-14)21-12-15-5-6-17(20)11-16(15)13-21/h3-8,11,22H,9-10,12-13H2,1-2H3.
What are the key properties of 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol?
4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol has a molecular weight of 299.39 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(5-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]phenol is sourced from PubChem (CID 170659388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).