C38H53NSSi — CID 170660437
[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(pentan-3-yl)silane (PubChem CID 170660437) has the molecular formula C38H53NSSi and a molecular weight of 584.00 g/mol. Its IUPAC name is [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(pentan-3-yl)silane.
| Compound Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(pentan-3-yl)silane |
|---|---|
| PubChem CID | 170660437 |
| Molecular Formula | C38H53NSSi |
| Molecular Weight | 584.00 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(pentan-3-yl)silane |
| SMILES | CCC(CC)[Si](c1sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc2c1C)(C(CC)CC)C1CCCCC1 |
| InChI | InChI=1S/C38H53NSSi/c1-9-29(10-2)41(30(11-3)12-4,31-19-14-13-15-20-31)37-26(5)32-22-23-39-35(36(32)40-37)28-24-27-18-16-17-21-33(27)34(25-28)38(6,7)8/h16-18,21-25,29-31H,9-15,19-20H2,1-8H3 |
| InChIKey | SOSMHIFDSPJFBO-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.00 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|