C22H20INO — CID 170660648
7-(4-tert-butylnaphthalen-2-yl)-2-iodo-3-methylfuro[2,3-c]pyridine (PubChem CID 170660648) has the molecular formula C22H20INO and a molecular weight of 441.31 g/mol. Its IUPAC name is 7-(4-tert-butylnaphthalen-2-yl)-2-iodo-3-methylfuro[2,3-c]pyridine.
| Compound Name | 7-(4-tert-butylnaphthalen-2-yl)-2-iodo-3-methylfuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 170660648 |
| Molecular Formula | C22H20INO |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 7-(4-tert-butylnaphthalen-2-yl)-2-iodo-3-methylfuro[2,3-c]pyridine |
| SMILES | Cc1c(I)oc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C22H20INO/c1-13-16-9-10-24-19(20(16)25-21(13)23)15-11-14-7-5-6-8-17(14)18(12-15)22(2,3)4/h5-12H,1-4H3 |
| InChIKey | MCXCYWLIKGUSGS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|