C16H16F5N5O — CID 170661524
11-[(1S)-3,3-difluorocyclopentyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 170661524) has the molecular formula C16H16F5N5O and a molecular weight of 389.33 g/mol. Its IUPAC name is 11-[(1S)-3,3-difluorocyclopentyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 11-[(1S)-3,3-difluorocyclopentyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 170661524 |
| Molecular Formula | C16H16F5N5O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 11-[(1S)-3,3-difluorocyclopentyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C(F)(F)F)CN(C(N)=O)c2cnc3cc([C@H]4CCC(F)(F)C4)nn3c21 |
| InChI | InChI=1S/C16H16F5N5O/c1-14(16(19,20)21)7-25(13(22)27)10-6-23-11-4-9(24-26(11)12(10)14)8-2-3-15(17,18)5-8/h4,6,8H,2-3,5,7H2,1H3,(H2,22,27)/t8-,14?/m0/s1 |
| InChIKey | OBZPXMNZLWGKRS-BVVIDWAXSA-N |
| XLogP | 3.35 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |