C44H28O — CID 170662888
6-(2,3,4,5,6-pentadeuteriophenyl)-3-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran (PubChem CID 170662888) has the molecular formula C44H28O and a molecular weight of 586.79 g/mol. Its IUPAC name is 6-(2,3,4,5,6-pentadeuteriophenyl)-3-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran.
| Compound Name | 6-(2,3,4,5,6-pentadeuteriophenyl)-3-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 170662888 |
| Molecular Formula | C44H28O |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 6-(2,3,4,5,6-pentadeuteriophenyl)-3-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3c4ccccc4c(-c4ccc5c(c4)oc4c(-c6c([2H])c([2H])c([2H])c([2H])c6[2H])cccc45)c4ccccc34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C44H28O/c1-3-12-29(13-4-1)30-22-24-32(25-23-30)42-36-16-7-9-18-38(36)43(39-19-10-8-17-37(39)42)33-26-27-35-40-21-11-20-34(31-14-5-2-6-15-31)44(40)45-41(35)28-33/h1-28H/i1D,2D,3D,4D,5D,6D,12D,13D,14D,15D,22D,23D,24D,25D |
| InChIKey | UDBYIFPNVGXUNQ-VKTVRASHSA-N |
| XLogP | 12.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|