C44H26O2 — CID 170663265
1,2,3,4,6,7,8-heptadeuterio-9-[10-[2,4,6,7,8,9-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]anthracen-9-yl]dibenzofuran (PubChem CID 170663265) has the molecular formula C44H26O2 and a molecular weight of 604.80 g/mol. Its IUPAC name is 1,2,3,4,6,7,8-heptadeuterio-9-[10-[2,4,6,7,8,9-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]anthracen-9-yl]dibenzofuran.
| Compound Name | 1,2,3,4,6,7,8-heptadeuterio-9-[10-[2,4,6,7,8,9-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 170663265 |
| Molecular Formula | C44H26O2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 1,2,3,4,6,7,8-heptadeuterio-9-[10-[2,4,6,7,8,9-hexadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(-c3c4ccccc4c(-c4c([2H])c([2H])c([2H])c5oc6c([2H])c([2H])c([2H])c([2H])c6c45)c4ccccc34)c3c(oc4c([2H])c([2H])c([2H])c([2H])c43)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C44H26O2/c1-2-13-27(14-3-1)28-25-36(44-34-20-9-11-23-38(34)46-40(44)26-28)42-31-17-6-4-15-29(31)41(30-16-5-7-18-32(30)42)35-21-12-24-39-43(35)33-19-8-10-22-37(33)45-39/h1-26H/i1D,2D,3D,8D,9D,10D,11D,12D,13D,14D,19D,20D,21D,22D,23D,24D,25D,26D |
| InChIKey | VYLAONUYCCCRTL-GOGUQTFYSA-N |
| XLogP | 12.79 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|