C44H28O2 — CID 170663620
2,3,4,6-tetradeuterio-5-[8-[10-(4-phenylphenyl)anthracen-9-yl]dibenzofuran-3-yl]phenol (PubChem CID 170663620) has the molecular formula C44H28O2 and a molecular weight of 592.73 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-[8-[10-(4-phenylphenyl)anthracen-9-yl]dibenzofuran-3-yl]phenol.
| Compound Name | 2,3,4,6-tetradeuterio-5-[8-[10-(4-phenylphenyl)anthracen-9-yl]dibenzofuran-3-yl]phenol |
|---|---|
| PubChem CID | 170663620 |
| Molecular Formula | C44H28O2 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-[8-[10-(4-phenylphenyl)anthracen-9-yl]dibenzofuran-3-yl]phenol |
| SMILES | [2H]c1c([2H])c(O)c([2H])c(-c2ccc3c(c2)oc2ccc(-c4c5ccccc5c(-c5ccc(-c6ccccc6)cc5)c5ccccc45)cc23)c1[2H] |
| InChI | InChI=1S/C44H28O2/c45-34-12-8-11-31(25-34)32-21-23-35-40-26-33(22-24-41(40)46-42(35)27-32)44-38-15-6-4-13-36(38)43(37-14-5-7-16-39(37)44)30-19-17-29(18-20-30)28-9-2-1-3-10-28/h1-27,45H/i8D,11D,12D,25D |
| InChIKey | HZOSWYNUFRZHFQ-SYVAPNLASA-N |
| XLogP | 12.27 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|