C44H28O — CID 170664325
1,2,3,4,7,9-hexadeuterio-6-phenyl-8-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran (PubChem CID 170664325) has the molecular formula C44H28O and a molecular weight of 587.80 g/mol. Its IUPAC name is 1,2,3,4,7,9-hexadeuterio-6-phenyl-8-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran.
| Compound Name | 1,2,3,4,7,9-hexadeuterio-6-phenyl-8-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 170664325 |
| Molecular Formula | C44H28O |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | 1,2,3,4,7,9-hexadeuterio-6-phenyl-8-[10-[2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c([2H])c2-c2c3ccccc3c(-c3c([2H])c(-c4ccccc4)c4oc5c([2H])c([2H])c([2H])c([2H])c5c4c3[2H])c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C44H28O/c1-3-15-29(16-4-1)32-19-7-8-21-34(32)43-37-24-11-9-22-35(37)42(36-23-10-12-25-38(36)43)31-27-39(30-17-5-2-6-18-30)44-40(28-31)33-20-13-14-26-41(33)45-44/h1-28H/i1D,3D,4D,7D,8D,13D,14D,15D,16D,19D,20D,21D,26D,27D,28D |
| InChIKey | LBHBSNWQYCSAEQ-XHEIZXRTSA-N |
| XLogP | 12.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|