C17H13Br2N3 — CID 170665123
3,5-bis(4-bromophenyl)-4-cyclopropyl-1,2,4-triazole (PubChem CID 170665123) has the molecular formula C17H13Br2N3 and a molecular weight of 419.12 g/mol. Its IUPAC name is 3,5-bis(4-bromophenyl)-4-cyclopropyl-1,2,4-triazole.
| Compound Name | 3,5-bis(4-bromophenyl)-4-cyclopropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 170665123 |
| Molecular Formula | C17H13Br2N3 |
| Molecular Weight | 419.12 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | 3,5-bis(4-bromophenyl)-4-cyclopropyl-1,2,4-triazole |
| SMILES | Brc1ccc(-c2nnc(-c3ccc(Br)cc3)n2C2CC2)cc1 |
| InChI | InChI=1S/C17H13Br2N3/c18-13-5-1-11(2-6-13)16-20-21-17(22(16)15-9-10-15)12-3-7-14(19)8-4-12/h1-8,15H,9-10H2 |
| InChIKey | QSZHRLFHARUVJN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |