C26H28F2N6 — CID 170665192
2-[3,5-bis[2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanamine (PubChem CID 170665192) has the molecular formula C26H28F2N6 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[3,5-bis[2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanamine.
| Compound Name | 2-[3,5-bis[2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 170665192 |
| Molecular Formula | C26H28F2N6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[3,5-bis[2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanamine |
| SMILES | NCCn1c(-c2ccc(C3=CCNCC3)cc2F)nnc1-c1ccc(C2=CCNCC2)cc1F |
| InChI | InChI=1S/C26H28F2N6/c27-23-15-19(17-5-10-30-11-6-17)1-3-21(23)25-32-33-26(34(25)14-9-29)22-4-2-20(16-24(22)28)18-7-12-31-13-8-18/h1-5,7,15-16,30-31H,6,8-14,29H2 |
| InChIKey | CXUCRUCRRSKYRM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |