C28H33N5O3 — CID 170665374
2-[3,5-bis[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol (PubChem CID 170665374) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[3,5-bis[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol.
| Compound Name | 2-[3,5-bis[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 170665374 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-[3,5-bis[3-methoxy-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol |
| SMILES | COc1cc(-c2nnc(-c3ccc(C4=CCNCC4)c(OC)c3)n2CCO)ccc1C1=CCNCC1 |
| InChI | InChI=1S/C28H33N5O3/c1-35-25-17-21(3-5-23(25)19-7-11-29-12-8-19)27-31-32-28(33(27)15-16-34)22-4-6-24(26(18-22)36-2)20-9-13-30-14-10-20/h3-7,9,17-18,29-30,34H,8,10-16H2,1-2H3 |
| InChIKey | ZDYCHQGOWOAGGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |