C21H25N3O3 — CID 170666510
11-hydroxy-3,4,4,8-tetramethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione (PubChem CID 170666510) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 11-hydroxy-3,4,4,8-tetramethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione.
| Compound Name | 11-hydroxy-3,4,4,8-tetramethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 170666510 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 11-hydroxy-3,4,4,8-tetramethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
| SMILES | CN1C(=O)c2c(O)c(=O)ccn2N2C1CCC(C)(C)C2(C)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O3/c1-20(2)12-10-16-22(4)19(27)17-18(26)15(25)11-13-23(17)24(16)21(20,3)14-8-6-5-7-9-14/h5-9,11,13,16,26H,10,12H2,1-4H3 |
| InChIKey | KRZWAZHWIFESOB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |