C31H47N3O5Si — CID 170666554
5-butoxy-3-(cyclopropylmethyl)-2-(4-hydroxy-4-phenylbutyl)-1-(2-trimethylsilylethoxymethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 170666554) has the molecular formula C31H47N3O5Si and a molecular weight of 569.82 g/mol. Its IUPAC name is 5-butoxy-3-(cyclopropylmethyl)-2-(4-hydroxy-4-phenylbutyl)-1-(2-trimethylsilylethoxymethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 5-butoxy-3-(cyclopropylmethyl)-2-(4-hydroxy-4-phenylbutyl)-1-(2-trimethylsilylethoxymethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 170666554 |
| Molecular Formula | C31H47N3O5Si |
| Molecular Weight | 569.82 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | 5-butoxy-3-(cyclopropylmethyl)-2-(4-hydroxy-4-phenylbutyl)-1-(2-trimethylsilylethoxymethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCCCOc1c2n(ccc1=O)N(COCC[Si](C)(C)C)C(CCCC(O)c1ccccc1)N(CC1CC1)C2=O |
| InChI | InChI=1S/C31H47N3O5Si/c1-5-6-19-39-30-27(36)17-18-33-29(30)31(37)32(22-24-15-16-24)28(34(33)23-38-20-21-40(2,3)4)14-10-13-26(35)25-11-8-7-9-12-25/h7-9,11-12,17-18,24,26,28,35H,5-6,10,13-16,19-23H2,1-4H3 |
| InChIKey | CKWJVOZNYMANHT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.82 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|