C21H21N3O4S — CID 170666575
S-[(3S,6S,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-trien-6-yl] ethanethioate (PubChem CID 170666575) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is S-[(3S,6S,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-trien-6-yl] ethanethioate.
| Compound Name | S-[(3S,6S,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-trien-6-yl] ethanethioate |
|---|---|
| PubChem CID | 170666575 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | S-[(3S,6S,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-trien-6-yl] ethanethioate |
| SMILES | COc1c2n(ccc1=O)N1[C@H](c3ccccc3)C=C[C@H](SC(C)=O)[C@H]1N(C)C2=O |
| InChI | InChI=1S/C21H21N3O4S/c1-13(25)29-17-10-9-15(14-7-5-4-6-8-14)24-20(17)22(2)21(27)18-19(28-3)16(26)11-12-23(18)24/h4-12,15,17,20H,1-3H3/t15-,17-,20-/m0/s1 |
| InChIKey | VMJOKMQGKXZRLY-KNBMTAEXSA-N |
| XLogP | 2.17 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|