About 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine
1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine (PubChem CID 170667194) has the molecular formula C14H14N2S
and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine.
Molecular Properties
| Compound Name | 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine |
| PubChem CID | 170667194 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine |
| SMILES | CC(C)C1=CSC2=NC=c3ccccc3=CN12 |
| InChI | InChI=1S/C14H14N2S/c1-10(2)13-9-17-14-15-7-11-5-3-4-6-12(11)8-16(13)14/h3-10H,1-2H3 |
| InChIKey | BISNPKKINAVXBG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine?
The IUPAC name of 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine (CID 170667194) is 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine.
What is the SMILES notation for 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine?
The canonical SMILES for 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine is CC(C)C1=CSC2=NC=c3ccccc3=CN12.
What is the InChIKey of 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine?
The InChIKey is BISNPKKINAVXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2S/c1-10(2)13-9-17-14-15-7-11-5-3-4-6-12(11)8-16(13)14/h3-10H,1-2H3.
What are the key properties of 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine?
1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine has a molecular weight of 242.35 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-[1,3]thiazolo[3,2-b][2,4]benzodiazepine is sourced from PubChem (CID 170667194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).