About 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium
1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium (PubChem CID 170667215) has the molecular formula C9H12N2Y-2
and a molecular weight of 237.12 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium |
| PubChem CID | 170667215 |
| Molecular Formula | C9H12N2Y-2 |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium |
| SMILES | CC(C)(C)/[C-]=C/n1[c-]ncc1.[Y] |
| InChI | InChI=1S/C9H12N2.Y/c1-9(2,3)4-6-11-7-5-10-8-11;/h5-7H,1-3H3;/q-2; |
| InChIKey | FDZHQIKZNHGXMC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium?
The IUPAC name of 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium (CID 170667215) is 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium.
What is the SMILES notation for 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium?
The canonical SMILES for 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium is CC(C)(C)/[C-]=C/n1[c-]ncc1.[Y].
What is the InChIKey of 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium?
The InChIKey is FDZHQIKZNHGXMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.Y/c1-9(2,3)4-6-11-7-5-10-8-11;/h5-7H,1-3H3;/q-2;.
What are the key properties of 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium?
1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium has a molecular weight of 237.12 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbut-1-enyl)-2H-imidazol-2-ide;yttrium is sourced from PubChem (CID 170667215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).