About tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate
tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate (PubChem CID 170668414) has the molecular formula C20H27N3O5
and a molecular weight of 389.45 g/mol. Its IUPAC name is tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate |
| PubChem CID | 170668414 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(Oc2ncc(C3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C20H27N3O5/c1-20(2,3)28-18(26)12-4-6-14(7-5-12)27-19-21-10-13(11-22-19)15-8-9-16(24)23-17(15)25/h10-12,14-15H,4-9H2,1-3H3,(H,23,24,25) |
| InChIKey | GUPZDOPFODDOGG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate?
The IUPAC name of tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate (CID 170668414) is tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate?
The canonical SMILES for tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate is CC(C)(C)OC(=O)C1CCC(Oc2ncc(C3CCC(=O)NC3=O)cn2)CC1.
What is the InChIKey of tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate?
The InChIKey is GUPZDOPFODDOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O5/c1-20(2,3)28-18(26)12-4-6-14(7-5-12)27-19-21-10-13(11-22-19)15-8-9-16(24)23-17(15)25/h10-12,14-15H,4-9H2,1-3H3,(H,23,24,25).
What are the key properties of tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate?
tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate has a molecular weight of 389.45 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[5-(2,6-dioxopiperidin-3-yl)pyrimidin-2-yl]oxycyclohexane-1-carboxylate is sourced from PubChem (CID 170668414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).