C21H32N2O2 — CID 170668441
N-(1-tert-butylpiperidin-4-yl)-4-(2,2-dimethylpropanoyl)benzamide (PubChem CID 170668441) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-(1-tert-butylpiperidin-4-yl)-4-(2,2-dimethylpropanoyl)benzamide.
| Compound Name | N-(1-tert-butylpiperidin-4-yl)-4-(2,2-dimethylpropanoyl)benzamide |
|---|---|
| PubChem CID | 170668441 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | N-(1-tert-butylpiperidin-4-yl)-4-(2,2-dimethylpropanoyl)benzamide |
| SMILES | CC(C)(C)C(=O)c1ccc(C(=O)NC2CCN(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O2/c1-20(2,3)18(24)15-7-9-16(10-8-15)19(25)22-17-11-13-23(14-12-17)21(4,5)6/h7-10,17H,11-14H2,1-6H3,(H,22,25) |
| InChIKey | KNPPMPOCXINVOK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |